Sulfonyl halides
eMolecules 139631-62-2 | cyclopropanesulfonyl chloride | Pharmablock | MFCD01631933 | 140.580 | C3H5ClO2S | 97.000 | ClS(=O)(=O)C1CC1 | 5g | 551282627
cyclopropanesulfonyl chloride | Pharmablock | 139631-62-2 | MFCD01631933 | 140.580 | C3H5ClO2S | 97.000 | ClS(=O)(=O)C1CC1 | 5g | 551282627
![eMolecules 941-55-9 | 4-METHYLBENZENESULFONYL AZIDE (30% W/W SOLUTION IN TOLUENE) | AstaTech | MFCD00180767 | 197.210 | C7H7N3O2S | 95.000 | Cc1ccc(cc1)S(=O)(=O)N=[N+]=[N-] | 100g | 277520639](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000211007.jpg-250.jpg)
eMolecules 941-55-9 | 4-METHYLBENZENESULFONYL AZIDE (30% W/W SOLUTION IN TOLUENE) | AstaTech | MFCD00180767 | 197.210 | C7H7N3O2S | 95.000 | Cc1ccc(cc1)S(=O)(=O)N=[N+]=[N-] | 100g | 277520639
4-METHYLBENZENESULFONYL AZIDE (30% W/W SOLUTION IN TOLUENE) | AstaTech | 941-55-9 | MFCD00180767 | 197.210 | C7H7N3O2S | 95.000 | Cc1ccc(cc1)S(=O)(=O)N=[N+]=[N-] | 100g | 277520639
eMolecules 592542-03-5 | 1-(5-Bromo-1-benzofuran-2-yl)ethanol | Apollo Scientific | MFCD08443121 | 241.084 | C10H9BrO2 | 95.000 | CC(O)c1cc2cc(Br)ccc2o1 | 1g | 562429759
1-(5-Bromo-1-benzofuran-2-yl)ethanol | Apollo Scientific | 592542-03-5 | MFCD08443121 | 241.084 | C10H9BrO2 | 95.000 | CC(O)c1cc2cc(Br)ccc2o1 | 1g | 562429759
![Alkali Scientific PMSF [Phenylmethylsulfonyl fluoride], 1 G](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000661193.jpg-250.jpg)
Alkali Scientific PMSF [Phenylmethylsulfonyl fluoride], 1 G
PMSF (Phenylmethylsulfonyl fluoride) is a potent protease inhibitor commonly used in protein protection protocols. This 1g quantity is ideal for laboratories where smaller quantities are needed for specific protein extraction or purification experiments. PMSF inhibits serine and cysteine proteases by irreversibly binding to their active sites, preventing unwanted protein degradation during sample preparation. It is widely used in cell biology and biochemistry for the isolation of intact proteins, maintaining their structure and function. PMSF is an essential reagent in experiments involving enzyme activity assays, proteomics studies, and tissue lysate preparation, helping preserve protein integrity during experimental procedures.
eMolecules 4025-64-3 | 3-(Chlorosulfonyl)benzoic acid | Combi-Blocks | MFCD00024877 | 220.620 | C7H5ClO4S | 97.000 | OC(=O)c1cccc(c1)S(Cl)(=O)=O | 25g | 205386588
3-(Chlorosulfonyl)benzoic acid | Combi-Blocks | 4025-64-3 | MFCD00024877 | 220.620 | C7H5ClO4S | 97.000 | OC(=O)c1cccc(c1)S(Cl)(=O)=O | 25g | 205386588
![Alkali Scientific PMSF [Phenylmethylsulfonyl fluoride], 5 G](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000661202.jpg-250.jpg)
Alkali Scientific PMSF [Phenylmethylsulfonyl fluoride], 5 G
PMSF (Phenylmethylsulfonyl fluoride) is a potent protease inhibitor that specifically targets serine proteases, effectively preventing protein degradation during biochemical and cellular analysis. Available in powder form, PMSF is used in research and laboratory applications that require the inhibition of unwanted protease activity. It is commonly employed in protein extraction procedures to stabilize proteins during isolation and purification, preventing proteolysis. PMSF is particularly useful in studies related to metabolic pathways, enzyme function, and protein synthesis. This reagent is essential in maintaining protein integrity in both in vitro and in vivo experiments where protease inhibition is crucial for accurate results.